Trang chủ Nón Nón vành thời trang RIBBON
NON-CM8-ribbon-299K(150cai)

Nón vành thời trang RIBBON

299,000

lien-he-ngay-moonlight-residences

Danh mục:

Mô tả

Dệt đan khéo léo tỉ mỉ thủ công bằng tay, phối kết hợp phụ kiện đóa hoa xinh xắn thời trang.Rất nhiều màu cho các bạn thoải mái lựa chọn.

Đánh giá

Chưa có đánh giá nào.

Hãy là người đầu tiên nhận xét “Nón vành thời trang RIBBON”

Thư điện tử của bạn sẽ không được hiển thị công khai. Các trường bắt buộc được đánh dấu *